Methylenedioxyallylamphetamine
|
Names
|
Preferred IUPAC name
N-[1-(2H-1,3-Benzodioxol-5-yl)propan-2-yl]prop-2-en-1-amine
|
Identifiers
|
|
|
|
|
ChemSpider
|
|
|
|
UNII
|
|
|
|
InChI=1S/C13H17NO2/c1-3-6-14-10(2)7-11-4-5-12-13(8-11)16-9-15-12/h3-5,8,10,14H,1,6-7,9H2,2H3 N Key: BMKCDDFQEGYEJC-UHFFFAOYSA-N N InChI=1/C13H17NO2/c1-3-6-14-10(2)7-11-4-5-12-13(8-11)16-9-15-12/h3-5,8,10,14H,1,6-7,9H2,2H3 Key: BMKCDDFQEGYEJC-UHFFFAOYAO
|
C1=C2C(=CC=C1CC(C)NCC=C)OCO2
|
Properties
|
|
C13H17NO2
|
Molar mass
|
219.284 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Methylenedioxyallylamphetamine (MDAL or 3,4-methylenedioxy-N-allylamphetamine) is a lesser-known psychedelic drug. It is also the N-allyl derivative of 3,4-methylenedioxyamphetamine (MDA). MDAL was first synthesized by Alexander Shulgin. In his book PiHKAL, the minimum dosage is listed as 180 mg, and the duration unknown.[1] MDAL produces few to no effects on its own, but may enhance the effects of LSD. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDAL.
Legality
United Kingdom
This substance is a Class A drug in the Drugs controlled by the UK Misuse of Drugs Act.[2]
See also
References
|
---|
Phenethylamines | |
---|
Amphetamines | |
---|
Phentermines | |
---|
Cathinones | |
---|
Phenylisobutylamines (and further-extended) | |
---|
Catecholamines (and close relatives) | |
---|
Cyclized phenethylamines | Phenylalkylpyrrolidines | |
---|
2-Benzylpiperidines (phenidates) | |
---|
Phenylmorpholines (phenmetrazines) | |
---|
Phenyloxazolamines (aminorexes) | |
---|
Isoquinolines and tetrahydroisoquinolines | |
---|
2-Aminoindanes | |
---|
2-Aminotetralins | |
---|
Others / unsorted |
- 1-Aminomethylindanes (e.g., 2CB-Ind, AMMI, bromojimscaline, jimscaline)
- 2-ADN
- 2-Benzhydrylpyrrolidine
- 2C-B-5-hemiFLY-α6 (BNAP)
- 3-Benzhydrylmorpholine
- 3-Phenylpiperidines (e.g., 3-phenylpiperidine, OSU-6162 (PNU-96391), LPH-5, LPH-48)
- 6-AB
- AL-1095
- Aminochromes (e.g., adrenochrome, adrenolutin)
- Benzazepines (e.g., fenoldopam, lorcaserin, SCHEMBL5334361)
- Benzocyclobutenes (e.g., 2CBCB-NBOMe, bromotomscaline, S33005, TCB-2, tomscaline)
- Benzoxepins (e.g., BBOX, IBOX, TFMBOX)
- Butyltolylquinuclidine
- Cypenamine (trans-2-phenylcyclopentylamine)
- Diphenidine
- Diphenylprolinol
- DMBMPP
- Ergolines (e.g., LSD)
- GYKI-52895
- HDMP-29
- Ivabradine
- Lumateperone and analogues (e.g., IHCH-7079, IHCH-7086, IHCH-7113, ITI-1549)
- Methoxphenidine
- Methylmorphenate
- Milnacipran
- MT-45
- 2-Naphthylamine
- Org 6582
- Partial ergolines (e.g., NDTDI, RU-27849, DEIMDHPCA, DEMPDHPCA, DEMPDHPCA-2C-D, RU-27251)
- PF-592,379
- Phenylcyclopropylamines (e.g., DMCPA, TMT, tranylcypromine)
- Tetrahydrobenzopyranylamines (e.g., CT-5126)
- Tricyclics (e.g., benzoctamine, dizocilpine)
- Z3517967757
- ZC-B
|
---|
|
---|
Related compounds |
- 2-Furylethylamine
- 2-Pyrrolylethylamine
- 3-Pyrrolylethylamine
- 3-Pyrrolylpropylamine
- 2-Tetrahydrofurylethylamine
- 4-Benzylpiperidine
- 7-AB
- Alkylamines (e.g., 1,3-DMBATooltip 1,3-dimethylbutylamine, 1,4-DMAATooltip 1,4-dimethylamylamine, heptaminol, iproheptine, isometheptene, methylhexanamine/1,3-DMAA, octodrine, oenethyl, tuaminoheptane)
- Benzylamines (e.g., benzylamine, α-methylbenzylamine, MDM1EA, ALPHA, M-ALPHA, pargyline)
- Benzylpiperazines (e.g., benzylpiperazine, MDBZP, fipexide)
- Cyclohexylaminopropanes (e.g., propylhexedrine, norpropylhexedrine)
- Cyclopentylaminopropanes (e.g., isocyclamine, cyclopentamine)
- Phenoxyethylamines (e.g., 3,4,5-trimethoxyphenoxyethylamine, CT-4719, ORG-37684)
- Phenylalkenylamines (e.g., phenylbutenamine)
- Phenylalkynylamines (e.g., phenylbutynamine)
- Phenylpiperazines (e.g., 1-phenylpiperazine, mCPPTooltip meta-chlorophenylpiperazine, TFMPPTooltip trifluoromethylphenylpiperazine, oMPPTooltip ortho-methylphenylpiperazine, pFPPTooltip para-fluorophenylpiperazine, pMeOPPTooltip para-methoxyphenylpiperazine)
- Phenylpropylamines (e.g., phenylpropylamine, homo-MDA, homo-MDMA)
- Thienylaminopropanes (thiopropamines) (e.g., thiopropamine, methiopropamine, thiothinone)
|
---|
- See also: Tryptamines
- Ergolines and lysergamides
- Stimulants
- Entactogens
- Psychedelics
|