DME
|
|
Names
|
Preferred IUPAC name
2-Amino-1-(3,4-dimethoxyphenyl)ethan-1-ol
|
Other names
3,4-Dimethoxy-beta-hydroxyphenethylamine 3,4-Dimethoxy-1-ethyl-(beta-hydroxy)amine
|
Identifiers
|
|
|
|
|
ChemSpider
|
|
|
|
UNII
|
|
|
|
InChI=1S/C10H15NO3/c1-13-9-4-3-7(8(12)6-11)5-10(9)14-2/h3-5,8,12H,6,11H2,1-2H3 Y Key: WIUFFBGZBFVVDL-UHFFFAOYSA-N Y InChI=1/C10H15NO3/c1-13-9-4-3-7(8(12)6-11)5-10(9)14-2/h3-5,8,12H,6,11H2,1-2H3 Key: WIUFFBGZBFVVDL-UHFFFAOYAL
|
COc1cc(ccc1OC)C(O)CN O(c1ccc(cc1OC)C(O)CN)C
|
Properties
|
|
C10H15NO3
|
Molar mass
|
197.234 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
DME, also known as 3,4-dimethoxy-β-hydroxyphenethylamine, is a lesser-known psychoactive drug of the BOx family. It is the β-hydroxy derivative of 3,4-dimethoxyphenethylamine. DME was first synthesized by Alexander Shulgin. In his book PiHKAL, the minimum dosage is listed as 115 mg, and the duration unknown. DME produces few to no effects.[1] Very little data exists about the pharmacological properties, metabolism, and toxicity of DME.
Legality
United Kingdom
This substance is a Class A drug in the Drugs controlled by the UK Misuse of Drugs Act.[2]
See also
References
|
---|
Phenethylamines | |
---|
Amphetamines | |
---|
Phentermines | |
---|
Cathinones | |
---|
Phenylisobutylamines (and further-extended) | |
---|
Catecholamines (and close relatives) | |
---|
Cyclized phenethylamines | Phenylalkylpyrrolidines | |
---|
2-Benzylpiperidines (phenidates) | |
---|
Phenylmorpholines (phenmetrazines) | |
---|
Phenyloxazolamines (aminorexes) | |
---|
Isoquinolines and tetrahydroisoquinolines | |
---|
2-Aminoindanes | |
---|
2-Aminotetralins | |
---|
Others / unsorted |
- 1-Aminomethylindanes (e.g., 2CB-Ind, AMMI, bromojimscaline, jimscaline)
- 2-ADN
- 2-Benzhydrylpyrrolidine
- 2C-B-5-hemiFLY-α6 (BNAP)
- 3-Benzhydrylmorpholine
- 3-Phenylpiperidines (e.g., 3-phenylpiperidine, OSU-6162 (PNU-96391), LPH-5, LPH-48)
- 6-AB
- AL-1095
- Aminochromes (e.g., adrenochrome, adrenolutin)
- Benzazepines (e.g., fenoldopam, lorcaserin, SCHEMBL5334361)
- Benzocyclobutenes (e.g., 2CBCB-NBOMe, bromotomscaline, S33005, TCB-2, tomscaline)
- Benzoxepins (e.g., BBOX, IBOX, TFMBOX)
- Butyltolylquinuclidine
- Cypenamine (trans-2-phenylcyclopentylamine)
- Diphenidine
- Diphenylprolinol
- DMBMPP
- Ergolines (e.g., LSD)
- GYKI-52895
- HDMP-29
- Ivabradine
- Lumateperone and analogues (e.g., IHCH-7079, IHCH-7086, IHCH-7113, ITI-1549)
- Methoxphenidine
- Methylmorphenate
- Milnacipran
- MT-45
- 2-Naphthylamine
- Org 6582
- Partial ergolines (e.g., NDTDI, RU-27849, DEIMDHPCA, DEMPDHPCA, DEMPDHPCA-2C-D, RU-27251)
- PF-592,379
- Phenylcyclopropylamines (e.g., DMCPA, TMT, tranylcypromine)
- Tetrahydrobenzopyranylamines (e.g., CT-5126)
- Tricyclics (e.g., benzoctamine, dizocilpine)
- Z3517967757
- ZC-B
|
---|
|
---|
Related compounds |
- 2-Furylethylamine
- 2-Pyrrolylethylamine
- 3-Pyrrolylethylamine
- 3-Pyrrolylpropylamine
- 2-Tetrahydrofurylethylamine
- 4-Benzylpiperidine
- 7-AB
- Alkylamines (e.g., 1,3-DMBATooltip 1,3-dimethylbutylamine, 1,4-DMAATooltip 1,4-dimethylamylamine, heptaminol, iproheptine, isometheptene, methylhexanamine/1,3-DMAA, octodrine, oenethyl, tuaminoheptane)
- Benzylamines (e.g., benzylamine, α-methylbenzylamine, MDM1EA, ALPHA, M-ALPHA, pargyline)
- Benzylpiperazines (e.g., benzylpiperazine, MDBZP, fipexide)
- Cyclohexylaminopropanes (e.g., propylhexedrine, norpropylhexedrine)
- Cyclopentylaminopropanes (e.g., isocyclamine, cyclopentamine)
- Phenoxyethylamines (e.g., 3,4,5-trimethoxyphenoxyethylamine, CT-4719, ORG-37684)
- Phenylalkenylamines (e.g., phenylbutenamine)
- Phenylalkynylamines (e.g., phenylbutynamine)
- Phenylpiperazines (e.g., 1-phenylpiperazine, mCPPTooltip meta-chlorophenylpiperazine, TFMPPTooltip trifluoromethylphenylpiperazine, oMPPTooltip ortho-methylphenylpiperazine, pFPPTooltip para-fluorophenylpiperazine, pMeOPPTooltip para-methoxyphenylpiperazine)
- Phenylpropylamines (e.g., phenylpropylamine, homo-MDA, homo-MDMA)
- Thienylaminopropanes (thiopropamines) (e.g., thiopropamine, methiopropamine, thiothinone)
|
---|
- See also: Tryptamines
- Ergolines and lysergamides
- Stimulants
- Entactogens
- Psychedelics
|