Ampelopsin B
|
Names
|
IUPAC name
(1S,7S,11bS)-1,7-Bis(4-hydroxyphenyl)-1,6,7,11b-tetrahydro-2-oxadibenzo[cd,h]azulene-4,8,10-triol
|
Other names
(+)-Ampelopsin B (−)-Ampelopsin B
|
Identifiers
|
|
|
|
|
ChEBI
|
|
ChemSpider
|
|
|
|
UNII
|
|
|
|
InChI=1S/C28H22O6/c29-17-5-1-14(2-6-17)21-10-16-9-19(31)13-24-25(16)27(22-11-20(32)12-23(33)26(21)22)28(34-24)15-3-7-18(30)8-4-15/h1-9,11-13,21,27-33H,10H2/t21-,27-,28+/m0/s1 Key: JJCVXDDMIRXVJA-YNOBPPCASA-N InChI=1/C28H22O6/c29-17-5-1-14(2-6-17)21-10-16-9-19(31)13-24-25(16)27(22-11-20(32)12-23(33)26(21)22)28(34-24)15-3-7-18(30)8-4-15/h1-9,11-13,21,27-33H,10H2/t21-,27-,28+/m0/s1 Key: JJCVXDDMIRXVJA-YNOBPPCABK
|
Oc1ccc(cc1)[C@H]6c2c(cc(O)cc2O)[C@H]4c5c(cc(O)cc5O[C@@H]4c3ccc(O)cc3)C6
|
Properties
|
|
C28H22O6
|
Molar mass
|
454.478 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Ampelopsin B is a stilbenoid dimer found in Ampelopsis glandulosa var. hancei (formerly Ampelopsis brevipedunculata var. hancei).[1][2]
References
- ^ Oshima, Y (1990). "Ampelopsins A, B and C, new oligostilbenes of Ampelopsis brevipedunculata var hancei". Tetrahedron. 46 (15): 5121. doi:10.1016/S0040-4020(01)87819-4.
- ^ Chemical determination of the absolute structures of resveratrol dimers, ampelopsins A, B, D and F. Yoshiaki Takaya, Ke-Xu Yan, Kenji Terashima, Junko Ito and Masatake Niwa, Tetrahedron, 2002, 58, pages 7259–7265, doi:10.1016/S0040-4020(02)00785-8
|
---|
- Diptoindonesin C
- Diptoindonesin F
- Gnetin H
- Hemsleyanol D
- Isohopeaphenol
- Laetevirenol A, B, C, D and E
- Suffruticosol A and B
- Viniferal
- E-ω-viniferin
- Z-ω-viniferin
|
Dimers |
- Diptoindonesin G
- Jezonodione
- B
- Scirpusin A
- Tibeticanol (piceatannol dimer)
|
---|
Trimers |
- Amurensin B
- Gnetin E
- Gneyulin A
- Johorenol A
- Ampelopsin E
- Vaticanol G
|
---|
Tetramers: |
- Dibalanocarpol
- Gnetin J (3"-hydroxygnetin E)
- Gnetin K (3"-methoxygnetin E)
- Gnetuhainin R (isorhapontigenin tetramer)
- Laetevirenol F and G
|
---|
Higher polymers (five units or more) | |
---|
Oligomeric forms of resveratrol | Dimers | |
---|
Trimers | |
---|
Tetramers | |
---|
Pentamers | |
---|
Hexamers | |
---|
Higher polymers |
- γ-viniferin
- Valeriaphenol A
|
---|
|
---|
Glycosides or conjugates |
- Diptoindonesin A (C-glucoside of ε-viniferin)
- Foeniculoside I (glucoside of miyabenol C), II, III and IV
- Laevifonol (an ε-viniferin-ascorbic acid hybrid compound)
- Laevifoside (O-glucoside of ampelopsin A)
|
---|