AM-906 |
|
(6aR,9R,10aR)-3-[(Z)-hept-1-enyl]-9-(hydroxymethyl)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
ChEMBL | |
---|
CompTox Dashboard (EPA) | |
---|
|
Formula | C23H34O3 |
---|
Molar mass | 358.522 g·mol−1 |
---|
3D model (JSmol) | |
---|
CCCCC/C=C\C1=CC2=C(C3CC(CCC3C(O2)(C)C)CO)C(=C1)O
|
InChI=1S/C23H34O3/c1-4-5-6-7-8-9-16-13-20(25)22-18-12-17(15-24)10-11-19(18)23(2,3)26-21(22)14-16/h8-9,13-14,17-19,24-25H,4-7,10-12,15H2,1-3H3/b9-8-/t17-,18-,19-/m1/s1 Y Key:NJIKRWBGUIYKJM-FORFBYLSSA-N Y
|
(verify) |
AM-906 (part of the AM cannabinoid series) is an analgesic drug which is a cannabinoid agonist. It is conformationally restricted by virtue of the double bond on its side chain, leading an increased affinity for and selectivity between CB1 and CB2 receptors.[1] It is a potent and selective agonist for the CB1 cannabinoid receptor, with a Ki of 0.8 nM at CB1 and 9.5 nM at CB2, a selectivity of almost 12x.[2]
The corresponding E or trans isomer is AM-905.
See also
References
- ^ Busch-Petersen J, Hill WA, Fan P, Khanolkar A, Xie XQ, Tius MA, Makriyannis A (September 1996). "Unsaturated side chain beta-11-hydroxyhexahydrocannabinol analogs". Journal of Medicinal Chemistry. 39 (19): 3790–6. doi:10.1021/jm950934b. PMID 8809166.
- ^ Papahatjis DP, Kourouli T, Abadji V, Goutopoulos A, Makriyannis A (March 1998). "Pharmacophoric requirements for cannabinoid side chains: multiple bond and C1'-substituted delta 8-tetrahydrocannabinols". Journal of Medicinal Chemistry. 41 (7): 1195–200. doi:10.1021/jm970277i. PMC 2291680. PMID 9544219.
|
---|
Phytocannabinoids (comparison) | Cannabibutols | |
---|
Cannabichromenes | |
---|
Cannabicyclols | |
---|
Cannabidiols | |
---|
Cannabielsoins | |
---|
Cannabigerols | |
---|
Cannabiphorols | |
---|
Cannabinols |
- CBN
- CBNA
- CBN-C1
- CBN-C2
- CBN-C4
- CBNM
- CBND
- CBNP
- CBVD
|
---|
Cannabitriols | |
---|
Cannabivarins | |
---|
Delta-3-tetrahydrocannabinols | |
---|
Delta-4-tetrahydrocannabinols | |
---|
Delta-7-tetrahydrocannabinols | |
---|
Delta-8-tetrahydrocannabinols | |
---|
Delta-9-tetrahydrocannabinols | |
---|
Delta-10-Tetrahydrocannabinols | |
---|
Delta-11-Tetrahydrocannabinols | |
---|
Miscellaneous cannabinoids | |
---|
Active metabolites | |
---|
|
---|
Endocannabinoids | |
---|
Synthetic cannabinoid receptor agonists / neocannabinoids | Classical cannabinoids (dibenzopyrans) | |
---|
Non-classical cannabinoids | |
---|
Adamantoylindoles | |
---|
Benzimidazoles | |
---|
Benzoylindoles | |
---|
Cyclohexylphenols | |
---|
Eicosanoids | |
---|
Indazole-3- carboxamides | |
---|
Indole-3-carboxamides | |
---|
Indole-3-carboxylates | |
---|
Naphthoylindazoles | |
---|
Naphthoylindoles | |
---|
Naphthoylpyrroles | |
---|
Naphthylmethylindenes | |
---|
Naphthylmethylindoles | |
---|
Phenylacetylindoles | |
---|
Pyrazolecarboxamides | |
---|
Tetramethylcyclo- propanoylindazoles | |
---|
Tetramethylcyclo- propanoylindoles | |
---|
Others | |
---|
|
---|
Allosteric CBRTooltip Cannabinoid receptor ligands | |
---|
Endocannabinoid enhancers (inactivation inhibitors) | |
---|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
---|
|