p-Coumaric acid glucoside
|
Names
|
IUPAC name
(2E)-3-[4-(β-D-Glucopyranosyloxy)phenyl]prop-2-enoic acid
|
Systematic IUPAC name
(2E)-3-(4-{[(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)prop-2-enoic acid
|
Other names
p-Coumaric acid 4-O-glucoside
|
Identifiers
|
|
|
|
|
ChemSpider
|
|
|
|
UNII
|
|
|
|
InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-3+/t10-,12-,13+,14-,15-/m1/s1 Key: LJFYQZQUAULRDF-FDGSXQGBSA-N InChI=1/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-3+/t10-,12-,13+,14-,15-/m1/s1 Key: LJFYQZQUAULRDF-FDGSXQGBBA
|
C1=CC(=CC=C1/C=C/C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O
|
Properties
|
|
C15H18O8
|
Molar mass
|
326.301 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
p-Coumaric acid glucoside is a hydroxycinnamic acid, an organic compound found in commercial breads containing flaxseed.[1]
References
- ^ Phenolic glucosides in bread containing flaxseed. C. Strandås, A. Kamal-Eldin, R. Andersson and P. Åman, Food Chemistry, Volume 110, Issue 4, 15 October 2008, Pages 997–999, doi:10.1016/j.foodchem.2008.02.088
External links
|
---|
Aglycones | Precursor | |
---|
Monohydroxycinnamic acids (Coumaric acids) | |
---|
Dihydroxycinnamic acids | |
---|
Trihydroxycinnamic acids | |
---|
O-methylated forms | |
---|
others | |
---|
|
---|
Esters | glycoside-likes | Esters of caffeic acid with cyclitols | |
---|
Glycosides |
- Ferulic acid glucoside
- 1-Sinapoyl-D-glucose
|
---|
|
---|
Tartaric acid esters | |
---|
Other esters with caffeic acid | |
---|
Caffeoyl phenylethanoid glycoside (CPG) |
- Echinacoside
- Calceolarioside A, B, C, F
- Chiritoside A, B, C
- Cistanoside A, B, C, D, E, F, G, H
- Conandroside
- Myconoside
- Pauoifloside
- Plantainoside A
- Plantamajoside
- Tubuloside B
- Verbascoside (Isoverbascoside, 2′-Acetylverbascoside)
|
---|
|
---|
Oligomeric forms | Dimers |
- Diferulic acids (DiFA) : 5,5′-Diferulic acid, 8-O-4′-Diferulic acid, 8,5′-Diferulic acid, 8,5′-DiFA (DC), 8,5′-DiFA (BF), 8,8′-Diferulic acid
|
---|
Trimers | |
---|
Tetramers | |
---|
|
---|
Conjugates with coenzyme A (CoA) | |
---|